| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | trans-(+)-Chrysanthemic acid Basic information |
| Product Name: | trans-(+)-Chrysanthemic acid | | Synonyms: | (1R,3R)-TRANS-2,2-DIMETHYL-3-(2-METHYL-1-PROPENYL)CYCLOPROPANE-1-CARBOXYLIC ACID;(+)-(1r,3r)-2,2-dimethyl-3-(2-methylpropenyl)cyclopropanecarboxylicacid;(1r-trans)-chrysanthemicacid;2,2-dimethyl-3-(2-methyl-1-propenyl)-cyclopropanecarboxylicaci(1r-trans;2,2-dimethyl-3-(2-methyl-1-propenyl)-cyclopropanecarboxylicaci(1theta-tr;2,2-dimethyl-3-(2-methylpropenyl)-,(1r,3r)-(+)-cyclopropanecarboxylicaci;(1R-trans)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylic acid;trans-(+)-Chrysanthemic acid, 99+% | | CAS: | 4638-92-0 | | MF: | C10H16O2 | | MW: | 168.23 | | EINECS: | 225-067-5 | | Product Categories: | | | Mol File: | 4638-92-0.mol |  |
| | trans-(+)-Chrysanthemic acid Chemical Properties |
| Melting point | 17-21 °C | | alpha | D25 +14.16° (c = 1.554 in abs alc) | | Boiling point | 255.81°C (rough estimate) | | density | 0.9934 (rough estimate) | | refractive index | n20/D 1.477 | | storage temp. | 0-6°C | | form | Liquid | | pka | 4.90±0.33(Predicted) | | color | Clear colorless to yellow | | Optical Rotation | [α]/D +14±1°, c = 2% in ethanol | | BRN | 4904351 | | InChI | 1S/C10H16O2/c1-6(2)5-7-8(9(11)12)10(7,3)4/h5,7-8H,1-4H3,(H,11,12)/t7-,8+/m1/s1 | | InChIKey | XLOPRKKSAJMMEW-SFYZADRCSA-N | | SMILES | C\C(C)=C/[C@@H]1[C@@H](C(O)=O)C1(C)C | | CAS DataBase Reference | 4638-92-0 | | EPA Substance Registry System | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1R,3R)- (4638-92-0) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | GZ1280000 | | F | 10-23 | | TSCA | TSCA listed | | HS Code | 29162090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | trans-(+)-Chrysanthemic acid Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid | | Uses | (+)-trans-Chrysanthemic Acid is a reactant in the synthesis of (1R,3R)-[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl (R)-2-acetoxy-3-methylbutanoate, the sex pheromone of Pseudococcus calceolariae, the citrophilous mealybug | | Uses | (+)-trans-Chrysanthemic acid may be used in the preparation of (+)-trans-pyrethric acid, a building block for rethrin II. | | Definition | ChEBI: (+)-trans-chrysanthemic acid is a trans-chrysanthemic acid in which both stereocentres have R configuration. It is functionally related to a (R,R)-chrysanthemal. It is a conjugate acid of a (R,R)-chrysanthemate. It is an enantiomer of a (-)-trans-chrysanthemic acid. | | General Description | (+)-trans-Chrysanthemic acid is the acidic component of synthetic pyrethroid insecticides. It can be prepared from (+)-Δ3-carene. |
| | trans-(+)-Chrysanthemic acid Preparation Products And Raw materials |
|