| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | trans,trans-2,4-Hexadienyl acetate Basic information |
| Product Name: | trans,trans-2,4-Hexadienyl acetate | | Synonyms: | aceticacid,2,4-hexadienylester;hexa-2,4-dienyl acetate;E,E-2,4-Hexadienyl acetate;TRANS,TRANS-2,4-HEXADIEN-1-YL ACETATE;2,4-Hexad;1-Acetoxy-2,4-hexadiene;Hexa-2,4-dienylacetat;trans,trans-2,4-Hexadienyl acetate | | CAS: | 1516-17-2 | | MF: | C8H12O2 | | MW: | 140.18 | | EINECS: | 216-163-8 | | Product Categories: | Building Blocks;C8 to C9;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;C8 to C9;Carbonyl Compounds;Esters | | Mol File: | 1516-17-2.mol |  |
| | trans,trans-2,4-Hexadienyl acetate Chemical Properties |
| Boiling point | 192-193 °C (lit.) | | density | 0.939 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.474(lit.) | | FEMA | 4132 | 2,4-HEXADIENYL ACETATE | | Fp | 182 °F | | storage temp. | Sealed in dry,Room Temperature | | Odor | Fragrance | | Odor Type | green | | Water Solubility | Insoluble in water. | | JECFA Number | 1780 | | BRN | 1702607 | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3 | | InChIKey | PXVKYPFROMBALG-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)C=CC=CC | | LogP | 1.91 | | CAS DataBase Reference | 1516-17-2(CAS DataBase Reference) | | EPA Substance Registry System | 2,4-Hexadien-1-ol, acetate (1516-17-2) |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | RTECS | AI0350000 | | TSCA | TSCA listed | | HS Code | 29153900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Dam. 1 | | Toxicity | LD50 orl-rat: 4360 mL/kg TXAPA9 28,313,74 |
| | trans,trans-2,4-Hexadienyl acetate Usage And Synthesis |
| Chemical Properties | Colorless liquid; powerful, sweet, pineapple aroma | | Definition | ChEBI: 2,4-Hexadienyl acetate is a carboxylic ester. | | Aroma threshold values | Medium strength odor, green type. | | Taste threshold values | Fresh green herbal soapy metallic taste at 25 ppm in water. | | Safety Profile | Moderately toxic by ingestion andskin contact. A skin and severe eye irritant. |
| | trans,trans-2,4-Hexadienyl acetate Preparation Products And Raw materials |
|