| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate oxalate(2:1) Basic information |
| | tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate oxalate(2:1) Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H22N2O2.C2H2O4/c1-11(2,3)16-10(15)14-8-12(9-14)5-4-6-13-7-12;3-1(4)2(5)6/h13H,4-9H2,1-3H3;(H,3,4)(H,5,6) | | InChIKey | NBFMPKLFGBQTIS-UHFFFAOYSA-N | | SMILES | C(=O)(O)C(=O)O.C(N1CC2(CNCCC2)C1)(=O)OC(C)(C)C |
| | tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate oxalate(2:1) Usage And Synthesis |
| | tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate oxalate(2:1) Preparation Products And Raw materials |
|