| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
|
| | Fmoc-Asp(OtBu)-Thr(psime,mepro)-OH Basic information |
| Product Name: | Fmoc-Asp(OtBu)-Thr(psime,mepro)-OH | | Synonyms: | Fmoc-L-Asp(tBu)-L-Thr[PSI(Me,Me)Pro]-OH;(9H-Fluoren-9-yl)MethOxy]Carbonyl Asp(OtBu)-ThrPsi(Me,Me)Pro-OH;Fmoc-Asp(tBu)-Thr[PSI(Me,Me)Pro]-OH;(4S,5R)-3-[Nα-(9-Fluorenylmethyloxycarbonyl)-L-aspartyl-tert-butyl ester]-2,2,5-trimethyloxazolidine-4-carboxylic acid;Fmoc-Asp(OtBu)-Thr[Psi(Me,Me)Pro]-OH≥ 99% (HPLC);Fmoc-Asp(OtBu)-Thr[Ψ(Me,Me)Pro]-OH;(betaS,4S)-4-Carboxy-beta-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2,2,5-trimethyl-gamma-oxo-3-oxazolidinebutanoic acid 3-(1,1-dimethylethyl) ester;FMOC-ASP(OTBU)-THR(ΨME,ME PRO)-OH_920519-32-0 | | CAS: | 920519-32-0 | | MF: | C30H36N2O8 | | MW: | 552.62 | | EINECS: | | | Product Categories: | peptide | | Mol File: | 920519-32-0.mol |  |
| | Fmoc-Asp(OtBu)-Thr(psime,mepro)-OH Chemical Properties |
| Boiling point | 753.3±60.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | pka | 3.03±0.60(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChIKey | NKQJRYSIZOXCTJ-SCAFVEDQNA-N | | SMILES | O(CC1C2C=CC=CC=2C2C=CC=CC1=2)C(=O)N[C@@H](CC(=O)OC(C)(C)C)C(=O)N1[C@H](C(=O)O)[C@@H](C)OC1(C)C |&1:18,30,34,r| |
| WGK Germany | WGK 2 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Asp(OtBu)-Thr(psime,mepro)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Asp(OtBu)-Thr(psime,mepro)-OH Preparation Products And Raw materials |
|