| Company Name: |
Xihu CO.LTD Gold |
| Tel: |
0519-15261475005 15261475005 |
| Email: |
249584640@qq.com |
|
| | Fmoc-Ala-Ser(yme,mepro)-OH Basic information |
| Product Name: | Fmoc-Ala-Ser(yme,mepro)-OH | | Synonyms: | (4S)-3-[(2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1-oxopropyl]-2,2-dimethyl-4-oxazolidinecarboxylic acid;Fmoc-Ala-Ser(psiMe,Mepro)-OH Novabiochem;(9H-Fluoren-9-yl)MethOxy]Carbonyl Ala-SerPsi(Me,Me)Pro-OH;(4S)-3-[(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid;FMOC-ALA-SER(ΨME,ME PRO)-OH_252554-78-2;(S)-3-[(S)-2-(Fmoc-amino)propanoyl]-2,2-dimethyloxazolidine-4-carboxylic Acid;4-Oxazolidinecarboxylic acid, 3-[(2S)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-1-oxopropyl]-2,2-dimethyl-, (4S)-;FMOC-ALA-SER(YME,MEPRO)-OH USP/EP/BP | | CAS: | 252554-78-2 | | MF: | C24H26N2O6 | | MW: | 438.47 | | EINECS: | | | Product Categories: | peptide | | Mol File: | 252554-78-2.mol |  |
| | Fmoc-Ala-Ser(yme,mepro)-OH Chemical Properties |
| Boiling point | 682.4±55.0 °C(Predicted) | | density | 1.292 | | storage temp. | Store at0-5°C | | form | Solid | | pka | 3.13±0.40(Predicted) | | color | White to off-white | | Major Application | peptide synthesis | | InChIKey | QMRGOZHWQFEGGB-XOBRGWDASA-N | | SMILES | O1C[C@@H](C(O)=O)N(C(=O)[C@@H](NC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)C)C1(C)C |
| WGK Germany | WGK 2 water endangering | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Ala-Ser(yme,mepro)-OH Usage And Synthesis |
| Description | Fmoc-Ala-Ser(Psi(Me,Me)pro)-OH is a linker with an Fmoc-protected amine and a terminal carboxylic acid. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can be reacted with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | White to beige powder | | Uses | Fmoc-Ala-Ser(psi(Me,Me)pro)-OH is a dipeptide. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Ala-Ser(yme,mepro)-OH Preparation Products And Raw materials |
|