| Company Name: |
Xihu CO.LTD Gold |
| Tel: |
0519-15261475005 15261475005 |
| Email: |
249584640@qq.com |
|
| | Fmoc-Gly-Ser[PSI(Me,Me)Pro]-OH Basic information |
| Product Name: | Fmoc-Gly-Ser[PSI(Me,Me)Pro]-OH | | Synonyms: | FMOC-GLU(OTBU)-THR(PSI-ME,MEPRO)-OH;(4S)-3-[2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]acetyl]-2,2-dimethyl-4-oxazolidinecarboxylic acid;(gammaS,4S)-4-Carboxy-gamma-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2,2,5-trimethyl-delta-oxo-3-oxazolidinepentanoic acid 3-(1,1-dimethylethyl) ester;(4S,5R)-3-[Nα-(9-Fluorenylmethyloxycarbonyl)-L-glutamyl-tert-butyl ester]-2,2,5-dimethyloxazolidine-4-carboxylic acid;Fmoc-Glu(OtBu)-Thr[Psi(Me,Me)Pro]-OH≥ 98.5% (HPLC);Fmoc-Glu(OtBu)-Thr[Ψ(Me,Me)Pro]-OH;(9H-Fluoren-9-yl)MethOxy]Carbonyl Glu(OtBu)-ThrPsi(Me,Me)Pro-OH;(9H-Fluoren-9-yl)MethOxy]Carbonyl Gly-Ser(Psi(Me,Me)Pro)-OH | | CAS: | 1095952-22-9 | | MF: | C23H24N2O6 | | MW: | 424.45 | | EINECS: | | | Product Categories: | peptide | | Mol File: | 1095952-22-9.mol | ![Fmoc-Gly-Ser[PSI(Me,Me)Pro]-OH Structure](CAS/20180906/GIF/1095952-22-9.gif) |
| | Fmoc-Gly-Ser[PSI(Me,Me)Pro]-OH Chemical Properties |
| Boiling point | 683.6±55.0 °C(Predicted) | | density | 1.316±0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | pka | 3.13±0.40(Predicted) | | form | Solid | | color | White to off-white | | Major Application | peptide synthesis | | InChIKey | XUBXHZJERGBCEL-IBGZPJMESA-N | | SMILES | O1C[C@@H](C(O)=O)N(C(CNC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)=O)C1(C)C |
| WGK Germany | WGK 2 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Gly-Ser[PSI(Me,Me)Pro]-OH Usage And Synthesis |
| Chemical Properties | White to pale beige powder | | Uses | Fmoc-glu(otbu)-thr(psi(me,me)pro)-OH is used in the synthesis of peptides. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Gly-Ser[PSI(Me,Me)Pro]-OH Preparation Products And Raw materials |
|