| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | H-Arg-Phe-OH acetate salt Basic information |
| Product Name: | H-Arg-Phe-OH acetate salt | | Synonyms: | H-ARG-PHE-OH ACOH;ARG-PHE ACETATE SALT;Arg-Phe-OH;L-Arg-L-Phe-OH;N-(L-Arginyl)-L-phenylalanine;(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid;(2S)-2-[[(2S)-2-amino-5-guanidino-pentanoyl]amino]-3-phenyl-propionic acid;(2S)-2-[[(2S)-2-azanyl-5-[bis(azanyl)methylideneamino]pentanoyl]amino]-3-phenyl-propanoic acid | | CAS: | 2047-13-4 | | MF: | C15H23N5O3 | | MW: | 321.37 | | EINECS: | | | Product Categories: | | | Mol File: | 2047-13-4.mol |  |
| | H-Arg-Phe-OH acetate salt Chemical Properties |
| density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | water: soluble | | pka | 3.40±0.10(Predicted) | | form | solid | | color | white to beige | | Water Solubility | water: soluble | | Sequence | Arg-Phe | | InChI | 1S/C15H23N5O3/c16-11(7-4-8-19-15(17)18)13(21)20-12(14(22)23)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,16H2,(H,20,21)(H,22,23)(H4,17,18,19)/t11-,12-/m0/s1 | | InChIKey | PQBHGSGQZSOLIR-RYUDHWBXSA-N | | SMILES | NC(NCCC[C@H](N)C(N[C@@H](CC1=CC=CC=C1)C(O)=O)=O)=N |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-Arg-Phe-OH acetate salt Usage And Synthesis |
| Uses | Arginylphenylalanine can be used in biochemical and metabolomics research applications | | Definition | ChEBI: A dipeptide formed from L-arginine and L-phenylalanine residues. It exhibits vasorelaxant activity. |
| | H-Arg-Phe-OH acetate salt Preparation Products And Raw materials |
|