|
|
| | 2,2-Diethoxyethanethioamide Basic information |
| | 2,2-Diethoxyethanethioamide Chemical Properties |
| Melting point | 91-94 ºC | | Boiling point | 214.5±50.0 °C(Predicted) | | density | 1.093±0.06 g/cm3(Predicted) | | pka | 12.46±0.29(Predicted) | | InChI | InChI=1S/C6H13NO2S/c1-3-8-6(5(7)10)9-4-2/h6H,3-4H2,1-2H3,(H2,7,10) | | InChIKey | MQSDGAKLSVITHP-UHFFFAOYSA-N | | SMILES | C(N)(=S)C(OCC)OCC | | CAS DataBase Reference | 73956-15-7 |
| | 2,2-Diethoxyethanethioamide Usage And Synthesis |
| Uses | 2,2-Diethoxyethanethioamide is an intermediate in the synthesis of Tubulysin M, an antimitotic peptide from myxobacteria. |
| | 2,2-Diethoxyethanethioamide Preparation Products And Raw materials |
|