| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 2-Cyanothioacetamide
-
- $10.00
-
2026-03-20
- CAS:7357-70-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100 mt
|
| | 2-Cyanothioacetamide Basic information |
| | 2-Cyanothioacetamide Chemical Properties |
| Melting point | 118-120 °C (lit.) | | Boiling point | 264.0±42.0 °C(Predicted) | | density | 1.241 (estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 12.18±0.29(Predicted) | | form | Needles or Powder | | color | Beige to brown | | Water Solubility | Does not mix well with water. | | Sensitive | Light Sensitive | | BRN | 1699934 | | InChI | InChI=1S/C3H4N2S/c4-2-1-3(5)6/h1H2,(H2,5,6) | | InChIKey | BHPYMZQTCPRLNR-UHFFFAOYSA-N | | SMILES | C(N)(=S)CC#N | | CAS DataBase Reference | 7357-70-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-36/37/39-36 | | RIDADR | UN 3439 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Harmful/Light Sensitive | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29309090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Cyanothioacetamide Usage And Synthesis |
| Chemical Properties | beige to brown needles or powder | | Uses | 2-Cyanothioacetamide was used in the synthesis of 3,4-trans-4-aryl-3-(1-pyridinio)-1,2,3,4-tetrahydropyridine-6-thiolates and bis[6-(2-aryl)-2-thioxo-1,2-dihydropyridine-3-carbonitrile]. 2-Cyanothioacetamide is used as a building block for 2-pyridothiones. It can be used in agrochemical, pharmaceutical and dyestuff field etc,. |
| | 2-Cyanothioacetamide Preparation Products And Raw materials |
|