| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Ac-Glu(OtBu)-OH manufacturers
- AC-GLU(OTBU)-OH
-
- $15.00
-
2021-07-13
- CAS:84192-88-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- AC-GLU(OTBU)-OH
-
- $15.00
-
2021-07-10
- CAS:84192-88-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- AC-GLU(OTBU)-OH
-
- $1.00
-
2020-01-05
- CAS:84192-88-1
- Min. Order: 1KG
- Purity: 95--99%
- Supply Ability: 1ton
|
| | Ac-Glu(OtBu)-OH Basic information |
| Product Name: | Ac-Glu(OtBu)-OH | | Synonyms: | N-ALPHA-ACETYL-L-GLUTAMIC ACID GAMMA-T-BUTYL ESTER;(2S)-2-AcetaMido-5-[(2-Methyl-2-propanyl)oxy]-5-oxopentanoic acid (non-preferred naMe);(S)-2-acetamido-5-tert-butoxy-5-oxopentanoic acid;REF DUPL: Ac-Glu(OtBu)-OH;N-Acetyl-L-glutamic acid 5-tert-butyl ester;ACETYL-L-GLUTAMIC ACID BETA-T-BUTYL ESTER;ACETYL-L-GLUTAMIC ACID GAMMA-T-BUTYL ESTER;AC-GLUTAMIC ACID(OTBU)-OH | | CAS: | 84192-88-1 | | MF: | C11H19NO5 | | MW: | 245.27 | | EINECS: | 200-258-5 | | Product Categories: | Amino Acids Derivatives;Amino Acids and Derivatives;Amino Acid Derivatives | | Mol File: | 84192-88-1.mol |  |
| | Ac-Glu(OtBu)-OH Chemical Properties |
| Boiling point | 464.0±40.0 °C(Predicted) | | density | 1.143±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.50±0.10(Predicted) | | form | Powder | | color | White | | InChI | InChI=1S/C11H19NO5/c1-7(13)12-8(10(15)16)5-6-9(14)17-11(2,3)4/h8H,5-6H2,1-4H3,(H,12,13)(H,15,16)/t8-/m0/s1 | | InChIKey | FALCCLKESWGSNI-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](CCC(OC(C)(C)C)=O)NC(C)=O | | CAS DataBase Reference | 84192-88-1 |
| | Ac-Glu(OtBu)-OH Usage And Synthesis |
| Chemical Properties | White powder |
| | Ac-Glu(OtBu)-OH Preparation Products And Raw materials |
|