- ETHYL 2-FLUOROACETOACETATE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1522-41-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | ETHYL 2-FLUOROACETOACETATE Basic information |
| Product Name: | ETHYL 2-FLUOROACETOACETATE | | Synonyms: | FLUOROACETOACETIC ACID ETHYL ESTER;ETHYL 2-FLUOROACETOACETATE;ETHYL-2-FLUORO-3-OXOBUTANOATE;ETHYL 2-FLUORO-3-OXOBUTYRATE;BUTYRIC ACID, 2-FLUORO-3-OXO-, ETHYL ESTER;2-FLUORO-3-OXO-BUTANOIC ACID ETHYL ESTER;2-FLUORO-3-OXO-BUTYRIC ACID ETHYL ESTER;2-Fluoroacetoacetic Acid Ethyl Ester | | CAS: | 1522-41-4 | | MF: | C6H9FO3 | | MW: | 148.13 | | EINECS: | 629-671-3 | | Product Categories: | Carbonyl Compounds;Esters;C6 to C7 | | Mol File: | 1522-41-4.mol |  |
| | ETHYL 2-FLUOROACETOACETATE Chemical Properties |
| Boiling point | 183 °C (lit.) | | density | 1.181 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.414(lit.) | | Fp | 194 °F | | storage temp. | Storage temp. 2-8°C | | pka | 9.25±0.46(Predicted) | | form | Liquid | | color | Clear colorless to pale yellow | | InChI | InChI=1S/C6H9FO3/c1-3-10-6(9)5(7)4(2)8/h5H,3H2,1-2H3 | | InChIKey | SHTFQLHOTAJQRJ-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(F)C(=O)C | | CAS DataBase Reference | 1522-41-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29183000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | ETHYL 2-FLUOROACETOACETATE Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | Reactant for:
- Michael addition-induced cyclization reaction
- Asymmetric Mannich reaction
- Enantioselective organocatalytic conjugate addition
| | Synthesis Reference(s) | Tetrahedron, 54, p. 2867, 1998 DOI: 10.1016/S0040-4020(98)83023-8 | | General Description | Ethyl 2-fluoroacetoacetate is an α-fluorinated β-keto ester that can be prepared by the fluorination of ethyl acetoacetate. |
| | ETHYL 2-FLUOROACETOACETATE Preparation Products And Raw materials |
|