|
|
| | Ethyl 2-chloro-4,4,4-trifluoroacetoacetate Basic information |
| Product Name: | Ethyl 2-chloro-4,4,4-trifluoroacetoacetate | | Synonyms: | Ethyl 2-chloro-4,4,4-trifluoroacetoacetate 95%;ART-CHEM-BB B023057;ETHYL 2-CHLORO-3-KETO-4,4,4-TRIFLUOROBUTYRATE;ETHYL 2-CHLORO-4,4,4-TRIFLUORO-3-OXOBUTYRATE;ETHYL 2-CHLORO-4,4,4-TRIFLUOROACETATE;ETHYL 2-CHLORO-4,4,4-TRIFLUOROACETOACETATE;2-CHLORO-4,4,4-TRIFLUORO-3-OXO-BUTYRIC ACID ETHYL ESTER;AKOS B023057 | | CAS: | 363-58-6 | | MF: | C6H6ClF3O3 | | MW: | 218.56 | | EINECS: | 670-525-3 | | Product Categories: | | | Mol File: | 363-58-6.mol |  |
| | Ethyl 2-chloro-4,4,4-trifluoroacetoacetate Chemical Properties |
| Boiling point | 67 °C | | density | 1.39 | | refractive index | 1.388 | | Fp | 28 | | storage temp. | 2-8°C, sealed storage, away from moisture | | pka | 4.96±0.35(Predicted) | | form | liquid | | color | Clear, colourless | | BRN | 1787023 | | InChI | InChI=1S/C6H6ClF3O3/c1-2-13-5(12)3(7)4(11)6(8,9)10/h3H,2H2,1H3 | | InChIKey | YVWUNJVPOCYLIM-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(Cl)C(=O)C(F)(F)F | | CAS DataBase Reference | 363-58-6(CAS DataBase Reference) |
| Hazard Codes | F,Xi | | Risk Statements | 34-36 | | Safety Statements | 26-36/37/39 | | RIDADR | 3265 | | Hazard Note | Flammable/Harmful | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2918300090 |
| | Ethyl 2-chloro-4,4,4-trifluoroacetoacetate Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Ethyl 2-Chloro-4,4,4-trifluoroacetoacetate is used in preparation of furoindazole derivatives as GPR84 antagonists useful in treating diseasess. |
| | Ethyl 2-chloro-4,4,4-trifluoroacetoacetate Preparation Products And Raw materials |
|