|
|
| | 6-Methoxy-pyridine-3-sulfonyl chloride Basic information |
| Product Name: | 6-Methoxy-pyridine-3-sulfonyl chloride | | Synonyms: | 6-Methoxypyridine-3-sulphonyl chloride;3-(Chlorosulphonyl)-6-methoxypyridine;5-(Chlorosulphonyl)-2-methoxypyridine;6-(Methyloxy)-3-pyridinesulfonyl chloride;3-Pyridinesulfonyl chloride, 6-methoxy-;12300-42-8;6-Methoxypyridine-3-sulfonyl chloride - [M9407];6-Methoxy-pyridine-3-sulfonyl chloride | | CAS: | 312300-42-8 | | MF: | C6H6ClNO3S | | MW: | 207.63 | | EINECS: | | | Product Categories: | | | Mol File: | 312300-42-8.mol |  |
| | 6-Methoxy-pyridine-3-sulfonyl chloride Chemical Properties |
| Boiling point | 320.4±22.0 °C(Predicted) | | density | 1.448±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | -3.56±0.11(Predicted) | | form | Crystalline Low Melting Solid | | color | White | | InChI | InChI=1S/C6H6ClNO3S/c1-11-6-3-2-5(4-8-6)12(7,9)10/h2-4H,1H3 | | InChIKey | OMLIVJOTRYWHNY-UHFFFAOYSA-N | | SMILES | C1=NC(OC)=CC=C1S(Cl)(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | WGK Germany | WGK 3 | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | 6-Methoxy-pyridine-3-sulfonyl chloride Usage And Synthesis |
| Uses | 6-Methoxypyridine-3-sulfonyl Chloride is used in the synthesis of pharmaceuticals. It is used as a reactant in the preparation of sulfonate analogs of combretastatin A-4 as potent antimitotic agents. Also used in the preparation of compounds with H+,K+-ATPase inhibitory action and gastric acid secretion inhibitory activities. |
| | 6-Methoxy-pyridine-3-sulfonyl chloride Preparation Products And Raw materials |
|