|
|
| | 3-FLUORO-2-NITROANILINE Basic information |
| Product Name: | 3-FLUORO-2-NITROANILINE | | Synonyms: | 3-FLUORO-2-NITROANILINE;3-Fluoro-2-nitroaniline 98%;2-Amino-6-fluoronitrobenzene;3-Fluoro-2-nitrobenzenaMine;Benzenamine, 3-fluoro-2-nitro-;3-Fluoro-2-nitro-phenylaMine;3-Fluro-2-nitroaniline | | CAS: | 567-63-5 | | MF: | C6H5FN2O2 | | MW: | 156.11 | | EINECS: | | | Product Categories: | | | Mol File: | 567-63-5.mol |  |
| | 3-FLUORO-2-NITROANILINE Chemical Properties |
| Boiling point | 305.7±22.0 °C(Predicted) | | density | 1.448 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | crystalline solid | | pka | -1.24±0.10(Predicted) | | color | Dark red | | InChI | InChI=1S/C6H5FN2O2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H,8H2 | | InChIKey | NSFGNLQLWFZHKK-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(F)=C1[N+]([O-])=O | | CAS DataBase Reference | 567-63-5 |
| Hazard Codes | Xi,C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2811 | | WGK Germany | WGK 3 | | Hazard Note | Harmful/Irritant | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2921420090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3-FLUORO-2-NITROANILINE Usage And Synthesis |
| Uses | 3-Fluoro-2-nitroaniline is a useful research chemical used in the preparation of benzylamines and quinoxaline-diones. |
| | 3-FLUORO-2-NITROANILINE Preparation Products And Raw materials |
|