| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | (Z)-11-TETRADECEN-1-YL ACETATE Basic information |
| Product Name: | (Z)-11-TETRADECEN-1-YL ACETATE | | Synonyms: | acetate,(z)-11-tetradecen-1-o;cis-11-Tetradecen-1-ol acetate;cis-11-Tetradecen-1-yl acetate;cis-11-tetradecen-1-ylacetate;cis-11-tetradecenyl;Z-11-Tetradecenol acetate;(Z)-11-TETRADECEN-1-YL ACETATE;(Z)-tetradec-11-enyl acetate | | CAS: | 20711-10-8 | | MF: | C16H30O2 | | MW: | 254.41 | | EINECS: | 243-982-8 | | Product Categories: | | | Mol File: | 20711-10-8.mol |  |
| | (Z)-11-TETRADECEN-1-YL ACETATE Chemical Properties |
| Melting point | <25℃ | | Boiling point | 316.2±11.0℃ (760 torr) | | density | 0.878±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.4515 (20℃) | | Fp | 87.2±17.6℃ | | storage temp. | 2-8°C | | solubility | Chloroform, Methanol (Sparingly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h4-5H,3,6-15H2,1-2H3/b5-4- | | InChIKey | YJINQJFQLQIYHX-PLNGDYQASA-N | | SMILES | C(OC(=O)C)CCCCCCCCC/C=C\CC | | LogP | 6.490 (est) | | CAS DataBase Reference | 20711-10-8 | | EPA Substance Registry System | (Z)-11-Tetradecen-1-ol acetate (20711-10-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | TSCA | TSCA listed |
| | (Z)-11-TETRADECEN-1-YL ACETATE Usage And Synthesis |
| Uses | (Z)-11-Tetradecenyl Acetate is a sex pheremone component that can be found in various insect specie, such as O. nubilalis and Asian and European corn borers. | | Definition | ChEBI: 11Z-Tetradecenyl acetate is a carboxylic ester. | | Application | (Z)-11-tetradecen-1-yl acetate is mainly used as a sex pheromone component for various lepidopteran pests such as corn borers, and is applied in agricultural pest monitoring and green control. |
| | (Z)-11-TETRADECEN-1-YL ACETATE Preparation Products And Raw materials |
|