H2N-PEG3-CH2COOtBu manufacturers
- NH2-PEG3-CH2COOtBu
-
- $899.00 / 100g
-
2026-01-24
- CAS:189808-70-6
- Min. Order: 10g
- Purity: 98%
- Supply Ability: 500kg
|
| | H2N-PEG3-CH2COOtBu Basic information |
| Product Name: | H2N-PEG3-CH2COOtBu | | Synonyms: | H2N-PEG3-CH2COOtBu;Amino-PEG3-CH2CO2-t-butyl ester;tert-Butyl 2-(2-(2-(2-aminoethoxy)ethoxy)ethoxy)acetate;Amino-peg3-butyl ester;NH2-PEG3-C1-Boc;Acetic acid, 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-, 1,1-dimethylethyl ester;NH2-PEG3-CH2COOtBu;Amino-PEG3-CH2COOtBu | | CAS: | 189808-70-6 | | MF: | C12H25NO5 | | MW: | 263.33 | | EINECS: | | | Product Categories: | PROTAC LINKER;peg | | Mol File: | 189808-70-6.mol |  |
| | H2N-PEG3-CH2COOtBu Chemical Properties |
| Boiling point | 343.4±27.0 °C(Predicted) | | density | 1.041±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | Liquid | | pka | 8.74±0.10(Predicted) | | color | Colorless to light yellow | | InChI | InChI=1S/C12H25NO5/c1-12(2,3)18-11(14)10-17-9-8-16-7-6-15-5-4-13/h4-10,13H2,1-3H3 | | InChIKey | OTTHWLFOQWLZKB-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)COCCOCCOCCN |
| | H2N-PEG3-CH2COOtBu Usage And Synthesis |
| Description | Amino-PEG3-CH2CO2-t-butyl ester is a PEG molecule containing an amino group with a t-butyl protected carboxyl group. The hydrophilic PEG spacer increases solubility in aqueous media. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The t-butyl protected carboxyl group (t-Boc) can be deprotected under acidic conditions. | | Uses | NH2-PEG3-C1-Boc (PROTAC Linker 5) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs; Alkyl/ether | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562. DOI:10.1016/j.ebiom.2018.09.005 |
| | H2N-PEG3-CH2COOtBu Preparation Products And Raw materials |
|