TERBUTHYLAZINE D5 manufacturers
|
| | TERBUTHYLAZINE D5 Basic information |
| Product Name: | TERBUTHYLAZINE D5 | | Synonyms: | TERBUTHYLAZINE D5;TERBUTYLAZINE-D5;TERBUTYLAZINE-D5 (ETHYL-D5);Terbuthylazine-D5 (ethyl-D5);6-Chloro-N-(1,1-dimethylethyl)-N'-(ethyl-d5)-1,3,5-triazine-2,4-diamine;D5-Terbuthylazine;Terbuthylazine D5Q: What is
Terbuthylazine D5 Q: What is the CAS Number of
Terbuthylazine D5;Terbuthylazine-d5 (ethyl-d5) in isooctane | | CAS: | 222986-60-9 | | MF: | C9H16ClN5 | | MW: | 229.71 | | EINECS: | | | Product Categories: | | | Mol File: | 222986-60-9.mol |  |
| | TERBUTHYLAZINE D5 Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO (Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15)/i1D3,5D2 | | InChIKey | FZXISNSWEXTPMF-RPIBLTHZSA-N | | SMILES | ClC1=NC(NC(C)(C)C)=NC(NC([2H])([2H])C([2H])([2H])[2H])=N1 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| | TERBUTHYLAZINE D5 Usage And Synthesis |
| Uses | Terbuthylazine-(ethyl-d5) is the deuterized or labeled form of Terbuthylazine (T110500), which is a triazine herbicide. |
| | TERBUTHYLAZINE D5 Preparation Products And Raw materials |
|