Adamantane-1-carboxamidine hydrochloride manufacturers
|
| | Adamantane-1-carboxamidine hydrochloride Basic information |
| Product Name: | Adamantane-1-carboxamidine hydrochloride | | Synonyms: | 1-ADAMANTANECARBAMIDINE HYDROCHLORIDE;adamantane-1-carboximidamide hydrochloride;Tricyclo[3.3.1.1~3,7~]decane-1-carboximidamide hydrochloride, Adamantane-1-carboximidamide hydrochloride;Adamantane-1-carboxamidine HCl;Adamantane-1-carboxamidine hydrochloride 95+%;1-adamantanecarboximidamide hydrochloride;Adamantane-1-carboxamidine hydrochloride | | CAS: | 50417-14-6 | | MF: | C11H19ClN2 | | MW: | 214.74 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 50417-14-6.mol |  |
| | Adamantane-1-carboxamidine hydrochloride Chemical Properties |
| Melting point | 225 | | form | powder | | color | White | | InChI | 1S/C11H18N2.ClH/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;/h7-9H,1-6H2,(H3,12,13);1H/t7-,8+,9-,11-; | | InChIKey | OJNFQKIOKKMCIM-IBVYXAFHSA-N | | SMILES | Cl.NC(=N)C12C[C@@H]3C[C@@H](C[C@@H](C3)C1)C2 | | CAS DataBase Reference | 50417-14-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2929900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Adamantane-1-carboxamidine hydrochloride Usage And Synthesis |
| | Adamantane-1-carboxamidine hydrochloride Preparation Products And Raw materials |
|