|
|
| | 2-Methylpropionamidine Basic information |
| Product Name: | 2-Methylpropionamidine | | Synonyms: | 2-methylpropanimidamide(SALTDATA: HCl);PropaniMidaMide, 2-Methyl-;isobutyriMidaMide;2-Methylpropionamidine | | CAS: | 57536-10-4 | | MF: | C4H10N2 | | MW: | 86.14 | | EINECS: | | | Product Categories: | | | Mol File: | 57536-10-4.mol |  |
| | 2-Methylpropionamidine Chemical Properties |
| Boiling point | 105-107 °C(Press: 20 Torr) | | density | 0.97±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.10±0.40(Predicted) | | InChI | InChI=1S/C4H10N2/c1-3(2)4(5)6/h3H,1-2H3,(H3,5,6) | | InChIKey | NDAJNMAAXXIADY-UHFFFAOYSA-N | | SMILES | C(N)(=N)C(C)C |
| | 2-Methylpropionamidine Usage And Synthesis |
| | 2-Methylpropionamidine Preparation Products And Raw materials |
|