|
|
| | FDNP-Val-NH2 Basic information |
| | FDNP-Val-NH2 Chemical Properties |
| Melting point | 173-177 °C(lit.) | | Boiling point | 537.5±50.0 °C(Predicted) | | density | 1.469±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | pka | 15.73±0.50(Predicted) | | Appearance | Light yellow to yellow Solid | | Optical Rotation | [α]20/D +14.0±1.5°, c = 2% in acetone | | InChI | 1S/C11H13FN4O5/c1-5(2)10(11(13)17)14-7-3-6(12)8(15(18)19)4-9(7)16(20)21/h3-5,10,14H,1-2H3,(H2,13,17)/t10-/m0/s1 | | InChIKey | ZTFFRKNPAXXEBL-JTQLQIEISA-N | | SMILES | CC(C)[C@H](Nc1cc(F)c(cc1[N+]([O-])=O)[N+]([O-])=O)C(N)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | FDNP-Val-NH2 Usage And Synthesis |
| Chemical Properties | Yellow powder | | Uses | N-(2,4-Dinitro-5-fluorophenyl)-L-valinamide is used in the synthesis of chiral variants of Marfey’s reagent. It is also used in the preparation of phaeofungin from Phaeosphaeria. |
| | FDNP-Val-NH2 Preparation Products And Raw materials |
|