- Marfey's reagent
-
- $356.00
-
2026-09-11
- CAS:95713-52-3
- Min. Order: 5g
- Purity: 0.97
- Supply Ability: 1kg
|
| | (S)-2-(5-fluoro-2,4-dinitrophenylaMino)propanaMide Basic information |
| | (S)-2-(5-fluoro-2,4-dinitrophenylaMino)propanaMide Chemical Properties |
| Melting point | 229 °C | | Boiling point | 544.5±50.0 °C(Predicted) | | density | 1.592±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | acetone: 10 mg/mL, clear, yellow | | form | powder | | pka | 15.61±0.50(Predicted) | | color | yellow to orange | | Optical Rotation | [α]20/D +56±2°, c = 1% in acetone | | BRN | 6820069 | | InChI | InChI=1S/C9H9FN4O5/c1-4(9(11)15)12-6-2-5(10)7(13(16)17)3-8(6)14(18)19/h2-4,12H,1H3,(H2,11,15)/t4-/m0/s1 | | InChIKey | NEPLBHLFDJOJGP-BYPYZUCNSA-N | | SMILES | C(N)(=O)[C@@H](NC1=CC(F)=C([N+]([O-])=O)C=C1[N+]([O-])=O)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-2-(5-fluoro-2,4-dinitrophenylaMino)propanaMide Usage And Synthesis |
| Chemical Properties | Light yellow to yellow crystal or powder | | Uses | FDAA was used as derivatizing reagent, in a study performed to understand unusual amino acids using reversed phase high performance liquid chromatography-electrospray ionization mass spectrometry (RPHPLC-ESI-MS). | | Uses | (S)-2-(5-fluoro-2,4-dinitrophenylaMino)propanaMide can be used for chiral amino acid analysis. | | Uses | N-α-(2,4-Dinitro-5-fluorophenyl)-L-alaninamide is suitable for use for the derivatization of amino acids. glutamate and analine present in cell wall. DerivatizedD- andL-amino acids can be resolved and quantitated by HPLC. | | General Description | Nα-(2,4-Dinitro-5-fluorophenyl)-L-alaninamide (FDAA) is a chiral derivatizing agent (CDA), has high enantioselectivity but low sensitivity as compared to other CDAs. It is generally used to assign the stereochemistry of amino acids in trace amounts. | | Biochem/physiol Actions | N-α-(2,4-Dinitro-5-fluorophenyl)-L-alaninamide (FDAA) is a chiral derivatizing agent and is used routinely to improve the detection of underivatized amino acids in high performance liquid chromatography. Its usage is effective in separating stereoisomer. |
| | (S)-2-(5-fluoro-2,4-dinitrophenylaMino)propanaMide Preparation Products And Raw materials |
|