- BOC-PHE-OSU
-
- $1.00
-
2024-07-20
- CAS:3674-06-4
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | BOC-PHE-OSU Basic information | | Uses |
| Product Name: | BOC-PHE-OSU | | Synonyms: | N-ALPHA-T-BOC-L-PHENYLALANINE N-HYDROXYSUCCINIMIDE ESTER;BOC-PHE-OSU;BOC-PHENYLALANINE-OSU;BOC-L-PHENYLALANINE N-HYDROXYSUCCINIMIDE ESTER;BOC-L-PHENYLALANINE HYDROXYSUCCINIMIDE ESTER;tert-Butyloxycarbonyl-L-phenylalanine N-hydroxysuccinimide ester;BOC-L-Phenylalanine Osu;N-T-boc-L-phenylalanine N-*hydroxysuccinimide est | | CAS: | 3674-06-4 | | MF: | C18H22N2O6 | | MW: | 362.38 | | EINECS: | 222-939-7 | | Product Categories: | | | Mol File: | 3674-06-4.mol |  |
| | BOC-PHE-OSU Chemical Properties |
| Melting point | 150-152 °C | | density | 1.28±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | -20°C | | form | Powder | | pka | 10.76±0.46(Predicted) | | color | White to off-white | | Optical Rotation | [α]20/D 21.0±1°, c = 1% in dioxane | | BRN | 715573 | | Major Application | peptide synthesis | | InChI | 1S/C18H22N2O6/c1-18(2,3)25-17(24)19-13(11-12-7-5-4-6-8-12)16(23)26-20-14(21)9-10-15(20)22/h4-8,13H,9-11H2,1-3H3,(H,19,24)/t13-/m0/s1 | | InChIKey | NHUCANAMPJGMQL-ZDUSSCGKSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)ON2C(=O)CCC2=O | | CAS DataBase Reference | 3674-06-4 |
| WGK Germany | 3 | | F | 3-10-21 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | BOC-PHE-OSU Usage And Synthesis |
| Uses | (2,5-Dioxopyrrolidin-1-yl) (2S)-2-(tert-butoxycarbonylamino)-3-phenyl-propanoate is a useful research chemical. | | Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-PHE-OSU Preparation Products And Raw materials |
|