| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | TOLUENE (RING-D5) Basic information |
| Product Name: | TOLUENE (RING-D5) | | Synonyms: | TOLUENE-2,3,4,5,6-D5, 98 ATOM % D;methylbenzene-d5;(2,3,4,5,6-2H5)Toluene;TOLUENE (RING-D5);TOLUENE-2,3,4,5,6-D5;1,2,3,4,5-pentadeuterio-6-methylbenzene;Toluene-d5;2,3,4,5,6-pentadeuteriotoluene | | CAS: | 1603-99-2 | | MF: | C7H8 | | MW: | 92.14 | | EINECS: | | | Product Categories: | | | Mol File: | 1603-99-2.mol |  |
| | TOLUENE (RING-D5) Chemical Properties |
| Melting point | -93 °C (lit.) | | Boiling point | 110 °C (lit.) | | density | 0.912 g/mL at 25 °C | | refractive index | n20/D 1.495(lit.) | | Fp | 40 °F | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | 1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3/i2D,3D,4D,5D,6D | | InChIKey | YXFVVABEGXRONW-VIQYUKPQSA-N | | SMILES | [2H]c1c([2H])c([2H])c(C)c([2H])c1[2H] | | CAS Number Unlabeled | 108-88-3 |
| Hazard Codes | F,Xn | | Risk Statements | 11-38-48/20-63-65-67 | | Safety Statements | 36/37-46-62 | | RIDADR | UN 1294 3/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 3
Asp. Tox. 1
Flam. Liq. 2
Repr. 2
Skin Irrit. 2
STOT RE 2 Inhalation
STOT SE 3 |
| | TOLUENE (RING-D5) Usage And Synthesis |
| Uses | Toluene-d8 is the isotope labelled analogue of Toluene (T535870), an aromatic hydrocarbon and the mono-substituted derivative of benzene. Toluene is widely used in industry as an building block for pharmaceutical goods and as well as an organic solvent in synthetic preparations. Toluene can also be used as an octane booster in gasoline fuels in internal combustion engines and as jet fuel surrogate. |
| | TOLUENE (RING-D5) Preparation Products And Raw materials |
|