|
|
| | FMOC-VAL-OPFP Basic information |
| | FMOC-VAL-OPFP Chemical Properties |
| Melting point | 121-122 °C | | Boiling point | 587.1±50.0 °C(Predicted) | | density | 1.3477 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 10.24±0.46(Predicted) | | form | Solid | | Major Application | peptide synthesis | | InChIKey | TZEGAVSWQUEHAQ-QHCPKHFHSA-N | | SMILES | Fc1c(c(c(c(c1F)F)OC(=O)[C@@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)C(C)C)F)F | | CAS DataBase Reference | 86060-87-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | FMOC-VAL-OPFP Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-VAL-OPFP Preparation Products And Raw materials |
|