| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Fmoc-Val-OPfp Basic information |
| Product Name: | Fmoc-Val-OPfp | | Synonyms: | FMOC-VALINE-OPFP;FMOC-L-VALINE PENTAFLUOROPHENYL ESTER;FMOC-L-VAL-OPFP;N-ALPHA-FMOC-L-VALINE PENTAFLUOROPHENYL ESTER;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-L-VALINE PENTAFLUORPHENYL ESTER;N-(9-FLUORENYLMETHOXYCARBONYL)-L-VALINE PENTAFLUOROPHENYL ESTER;N-ALPHA-FMOC-L-VALINE PENTAFLUOROPHENYL ESTER 98%;NALPHA-9-Fluorenylmethoxycarbonyl-L-valine pentafluorophenyl ester | | CAS: | 86060-87-9 | | MF: | C26H20F5NO4 | | MW: | 505.43 | | EINECS: | | | Product Categories: | Fmoc-Amino Acids and Derivatives;Fmoc-Amino acid series;Amino Acids | | Mol File: | 86060-87-9.mol |  |
| | Fmoc-Val-OPfp Chemical Properties |
| Melting point | 121-122 °C | | Boiling point | 587.1±50.0 °C(Predicted) | | density | 1.3477 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Solid | | pka | 10.24±0.46(Predicted) | | Major Application | peptide synthesis | | InChIKey | TZEGAVSWQUEHAQ-QHCPKHFHSA-N | | SMILES | Fc1c(c(c(c(c1F)F)OC(=O)[C@@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)C(C)C)F)F | | CAS DataBase Reference | 86060-87-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | Fmoc-Val-OPfp Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Val-OPfp Preparation Products And Raw materials |
|