|
|
| | 6-(FMOC-AMINO)-1-HEXANOL Basic information |
| Product Name: | 6-(FMOC-AMINO)-1-HEXANOL | | Synonyms: | 6-Fmoc-Acp-OL;Fmoc-Acp-OL;6-(Fmoc-amino)-1-hexanol≥ 98% (HPLC);FMOC-ACP(6)OL;FMOC-6-AMINOHEXANOL;FMOC-NH-(CH2)6-OH;6-(FMOC-AMINO)-1-HEXANOL;9H-FLUOREN-9-YLMETHYL N-(6-HYDROXYHEXYL)CARBAMATE | | CAS: | 127903-20-2 | | MF: | C21H25NO3 | | MW: | 339.43 | | EINECS: | | | Product Categories: | | | Mol File: | 127903-20-2.mol |  |
| | 6-(FMOC-AMINO)-1-HEXANOL Chemical Properties |
| Melting point | 119 °C | | Boiling point | 539.151±33.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.152±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | pka | 12.292±0.46(predicted) | | Appearance | White to off-white Solid | | BRN | 4531101 | | InChI | 1S/C21H25NO3/c23-14-8-2-1-7-13-22-21(24)25-15-20-18-11-5-3-9-16(18)17-10-4-6-12-19(17)20/h3-6,9-12,20,23H,1-2,7-8,13-15H2,(H,22,24) | | InChIKey | VGXOJZUTHIGHPT-UHFFFAOYSA-N | | SMILES | OCCCCCCNC(OCC1C(C=CC=C2)=C2C3=C1C=CC=C3)=O |
| Hazard Codes | Xi | | WGK Germany | 3 | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids |
| | 6-(FMOC-AMINO)-1-HEXANOL Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Reagent for the introduction of a spacer arm | | reaction suitability | reagent type: cross-linking reagent |
| | 6-(FMOC-AMINO)-1-HEXANOL Preparation Products And Raw materials |
|