L-1,2,3,4-TETRAHYDRONORHARMAN-3-CARBOXYLIC ACID manufacturers
- TNCA
-
- $31.00
-
2026-05-11
- CAS:42438-90-4
- Purity: 99.59%
- Supply Ability: 10g
|
| | L-1,2,3,4-TETRAHYDRONORHARMAN-3-CARBOXYLIC ACID Basic information |
| Product Name: | L-1,2,3,4-TETRAHYDRONORHARMAN-3-CARBOXYLIC ACID | | Synonyms: | L-TRYPTOLINE-3-CARBOXYLIC ACID;H-THNH(3)-OH;L-2,3,4-TETRAHYDRO-BETA-CARBOLINE-3-CARBOXYLIC ACID;L-1,2,3,4-TETRAHYDRO-9H-PYRIDO[3,4-B]INDOLE-3-CARBOXYLIC ACID;L-1,2,3,4-TETRAHYDRONORHARMAN-3-CARBOXYLIC ACID;1,2,3,4-TETRAHYDRONORHARMAN-L-3-CARBOXYLIC ACID;RARECHEM BK PT 0088;L-1,2,3,4-tetrahydronorharmane-3-carboxylic acid | | CAS: | 42438-90-4 | | MF: | C12H12N2O2 | | MW: | 216.24 | | EINECS: | | | Product Categories: | Phenylalanine analogs and other aromatic alpha amino acids;1 | | Mol File: | 42438-90-4.mol |  |
| | L-1,2,3,4-TETRAHYDRONORHARMAN-3-CARBOXYLIC ACID Chemical Properties |
| Melting point | 289 °C (dec.)(lit.) | | Boiling point | 485.0±45.0 °C(Predicted) | | density | 1.377±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | soluble1.5mg/mL, clear (Solvent: 0.1N HCl:DMSO (1:1); warmed) | | pka | 2.28±0.20(Predicted) | | form | powder | | color | white to beige | | Optical Rotation | [α]/D -57 to -67°, c = 1 (in MeOH:1N HCl (1:1)) | | InChI | 1S/C12H12N2O2/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10/h1-4,10,13-14H,5-6H2,(H,15,16)/t10-/m0/s1 | | InChIKey | FSNCEEGOMTYXKY-JTQLQIEISA-N | | SMILES | O=C(O)[C@H]1NCC2=C(C3=C(N2)C=CC=C3)C1 | | CAS DataBase Reference | 42438-90-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | L-1,2,3,4-TETRAHYDRONORHARMAN-3-CARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Lycoperodine-1 (Cyclomethyltryptophan) is an active product that can be isolated from tomato fruits (Lycopersicon sculentum). Lycoperodine-1 act as an agonist of Ca2+ sensing receptors (CaSR)[1]. | | Biochem/physiol Actions | TNCA is a tryptophan derivative that binds the parathyroid Ca2+-sensing receptor (CaSR) extracellular domain (ECD) hinge region between two globular subdomains and acts as a high-affinity CaSR ligand (CaSRL) with co-agonist activity. TNCA is shown to potentiate both Mg++- and Ca++-evoked cellular calcium response (0.1-0.5 mM), as well as Mg++-evoked cellular ERK1/2 phosphorylation in CaSR-expressing HEK293 cells (0.5 mM). AC-265347 (Cat. No. SML0129), on the other hand, is a calcimimetic that functions as a CaSR agonist. | | References | [1] Shoji Yahara, et al. Steroidal Alkaloid Glycosides from Tomato (Lycopersicon esculentum). J Nat Prod. 2004 Mar;67(3):500-2. DOI:10.1021/np030382x |
| | L-1,2,3,4-TETRAHYDRONORHARMAN-3-CARBOXYLIC ACID Preparation Products And Raw materials |
|