Fmoc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid manufacturers
|
| | Fmoc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid Basic information |
| Product Name: | Fmoc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid | | Synonyms: | RARECHEM BK PT 0090;(S)-2-FMOC-1,2,3,4-TETRAHYDRONORHARMANE-3-CARBOXYLIC ACID;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-L-1,2,3,4-TETRAHYDRONORHAM-3-CARBOXYLIC ACID;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-L-TRYPTOLINE-3-CARBOXYLIC ACID;FMOC-L-TPI;FMOC-TPI-OH;FMOC-THNH(3)-OH;FMOC-L-1,2,3,4-TETRAHYDRO-9H-PYRIDO-[3,4-B]-INDOLE-3-CARBOXYLIC ACID | | CAS: | 204322-23-6 | | MF: | C27H22N2O4 | | MW: | 438.48 | | EINECS: | | | Product Categories: | Phenylalanine analogs and other aromatic alpha amino acids;Others;Peptide Synthesis;Unnatural Amino Acid Derivatives | | Mol File: | 204322-23-6.mol |  |
| | Fmoc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid Chemical Properties |
| Boiling point | 702.4±60.0 °C(Predicted) | | density | 1.396±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.92±0.20(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D +56±2°, c = 1% in DMF | | Major Application | peptide synthesis | | InChIKey | IHHULIKSMJSELI-VWLOTQADSA-N | | SMILES | OC(=O)[C@@H]1Cc2c(CN1C(=O)OCC3c4ccccc4-c5ccccc35)[nH]c6ccccc26 | | CAS DataBase Reference | 204322-23-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| | Fmoc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid Preparation Products And Raw materials |
|