| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Bromo-3,5-dimethoxybenzaldehyde Basic information |
| | 4-Bromo-3,5-dimethoxybenzaldehyde Chemical Properties |
| Melting point | 110-111°C | | Boiling point | 336.6±42.0 °C(Predicted) | | density | 1.482±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | form | powder to crystal | | color | White to Light yellow to Green | | InChI | InChI=1S/C9H9BrO3/c1-12-7-3-6(5-11)4-8(13-2)9(7)10/h3-5H,1-2H3 | | InChIKey | UGBJRYUNSXFPOX-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(OC)=C(Br)C(OC)=C1 | | CAS DataBase Reference | 31558-40-4(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 4-Bromo-3,5-dimethoxybenzaldehyde Usage And Synthesis |
| Uses | 4-BROMO-3,5-DIMETHOXYBENZALDEHYDE is a fundamental chemical building block used in the synthesis of more complex structures. |
| | 4-Bromo-3,5-dimethoxybenzaldehyde Preparation Products And Raw materials |
|