| Company Name: |
AAB-PHARMA LIMITED Gold |
| Tel: |
025-66800956 18800000000 |
| Email: |
sales@njdmchem.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-Bromo-2,4-dimethoxybenzaldehyde Basic information |
| | 5-Bromo-2,4-dimethoxybenzaldehyde Chemical Properties |
| Melting point | 140-141 °C (lit.) | | Boiling point | 344.3±37.0 °C(Predicted) | | density | 1.482±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C9H9BrO3/c1-12-8-4-9(13-2)7(10)3-6(8)5-11/h3-5H,1-2H3 | | InChIKey | PXDIELLGFUEAIX-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(Br)=C(OC)C=C1OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Bromo-2,4-dimethoxybenzaldehyde Usage And Synthesis |
| Uses | 5-Bromo-2,4-dimethoxybenzaldehyde has been used in the preparation of 1,2-dihydro-4,6-dimethoxy-3-methylbenzocyclobuten-1-ol. | | General Description | 5-Bromo-2,4-dimethoxybenzaldehyde undergoes coupling with benzo[b]thiophene-2-boronic acid in the presence of tetrakis(triphenylphosphine)palladium(0) to give 5-(benzo[b]thien-2-yl)-2,4-dimethoxybenzaldehyde. |
| | 5-Bromo-2,4-dimethoxybenzaldehyde Preparation Products And Raw materials |
|