| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | N-(tert-Butoxycarbonyl)-L-alanine-3-13C Basic information |
| Product Name: | N-(tert-Butoxycarbonyl)-L-alanine-3-13C | | Synonyms: | L-Alanine-3-13C, N-t-Boc derivative;N-(TERT-BUTOXYCARBONYL)-L-ALANINE-3-13C, 99 ATOM % 13C;boc-ala-oh-3-13c;N-(tert-Butoxycarbonyl)-L-alanine-3-13C, L-Alanine-3-13C, N-t-Boc derivative;Boc-Ala-OH-3-13C;N-(tert-Butoxycarbonyl)-L-alanine-3-13C | | CAS: | 201740-79-6 | | MF: | C8H15NO4 | | MW: | 190.22 | | EINECS: | | | Product Categories: | | | Mol File: | 201740-79-6.mol |  |
| | N-(tert-Butoxycarbonyl)-L-alanine-3-13C Chemical Properties |
| Melting point | 79-83 °C(lit.) | | form | solid | | Optical Rotation | [α]20/D -23°, c =2 in acetic acid | | Major Application | peptide synthesis | | InChI | 1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1/i1+1 | | InChIKey | QVHJQCGUWFKTSE-BXMHHZGSSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H]([13CH3])C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-(tert-Butoxycarbonyl)-L-alanine-3-13C Usage And Synthesis |
| | N-(tert-Butoxycarbonyl)-L-alanine-3-13C Preparation Products And Raw materials |
|