| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | L-Alanine (3-13C) Basic information |
| Product Name: | L-Alanine (3-13C) | | Synonyms: | L-ALANINE-3-13C, 99 ATOM % 13C;3,3,3-D3, 98%);3,3,3- D3;3,3,3-d3;L-Alanine-3-13C;L-Alanine-13C;L-Alanine (3-13C) | | CAS: | 65163-25-9 | | MF: | C3H7NO2 | | MW: | 90.09 | | EINECS: | | | Product Categories: | Alphabetical Listings;Amino AcidsStable Isotopes;AStable Isotopes;MRI/MRS;Amino Acids 13C, 2H, 15N;Amino Acids;Metabolic Research;Stable Isotopes | | Mol File: | 65163-25-9.mol |  |
| | L-Alanine (3-13C) Chemical Properties |
| Melting point | 314.5 °C (dec.) (lit.) | | density | 1.161±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | Optical Rotation | [α]25/D +14.5°, c = 2 in 1 M HCl | | InChI | 1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1+1 | | InChIKey | QNAYBMKLOCPYGJ-IJGDANSWSA-N | | SMILES | [H][C@@]([13CH3])(N)C(O)=O | | CAS Number Unlabeled | 56-41-7 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Alanine (3-13C) Usage And Synthesis |
| Uses | For R&D use only. Not for drug, household, or other uses. Any other use is the sole responsibility of the end user.
Endotoxin testing is done on the bulk form of the product before subdivision packaging. This bulk test does not guarantee th at the subdivision or repackaged aliquot is endotoxin-free when it is received or used by the customer and does not imply suitability for any particular purpose. If the product must be endotoxin-free for the intended application, the product should be tested prior to actual use. |
| | L-Alanine (3-13C) Preparation Products And Raw materials |
|