- PONGAMOL
-
-
2026-06-30
- CAS:484-33-3
- Min. Order: 1KG
- Purity: 95.0%
- Supply Ability: 10000KGS
- Pongamol
-
- $1400.00
-
2024-04-02
- CAS:484-33-3
- Min. Order: 1g
- Purity: 97
- Supply Ability: 500 Kg
- pongamol
-
- $1.10
-
2022-02-25
- CAS:484-33-3
- Min. Order: 100g
- Purity: 99%
- Supply Ability: 20tons
|
| | PONGAMOL Basic information |
| Product Name: | PONGAMOL | | Synonyms: | 1-(5-benzofuranyl)-3-phenylpropane-1,3-dione;PONGAMOL;pongamiaextract,pongamol;pongamolfrompongamiaglabrafruits;1-(4-METHOXY-5-BENZOFURANYL)-3-PHENYL-1,3-PROPANEDIONE;1-(4-Methoxybenzofuran-5-yl)-3-phenyl-1,3-propanedione;1-(4-methoxybenzofuran-5-yl)-3-phenylpropane-1,3-dione;1-(4-methoxy-1-benzofuran-5-yl)-3-phenylpropane-1,3-dione | | CAS: | 484-33-3 | | MF: | C18H14O4 | | MW: | 294.3 | | EINECS: | 414-540-3 | | Product Categories: | Heterocycles | | Mol File: | 484-33-3.mol |  |
| | PONGAMOL Chemical Properties |
| Melting point | 126-130 °C | | Boiling point | 477.9±35.0 °C(Predicted) | | density | 1.237±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol | | form | Solid | | pka | 6.86±0.23(Predicted) | | color | Light Orange to Orange | | Major Application | food and beverages
pharmaceutical | | Cosmetics Ingredients Functions | FRAGRANCE | | InChI | InChI=1S/C18H14O4/c1-21-18-13(7-8-17-14(18)9-10-22-17)16(20)11-15(19)12-5-3-2-4-6-12/h2-10H,11H2,1H3 | | InChIKey | XTLSKKJNOIMMBK-UHFFFAOYSA-N | | SMILES | C(C1=CC=C2OC=CC2=C1OC)(=O)CC(C1=CC=CC=C1)=O | | LogP | 2.676 (est) | | CAS DataBase Reference | 484-33-3 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | F | 10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | PONGAMOL Usage And Synthesis |
| Uses | food and beverages
pharmaceutical |
| | PONGAMOL Preparation Products And Raw materials |
|