|
|
| | 1-Hexyl-3-methylimidazolium tetrafluoroborate Basic information |
| | 1-Hexyl-3-methylimidazolium tetrafluoroborate Chemical Properties |
| Melting point | -82 °C | | density | 1.149 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.430 | | storage temp. | Inert atmosphere,Room Temperature | | form | liquid | | color | yellow | | BRN | 8366236 | | Stability: | hygroscopic | | InChI | InChI=1S/C10H19N2.BF4/c1-3-4-5-6-7-12-9-8-11(2)10-12;2-1(3,4)5/h8-10H,3-7H2,1-2H3;/q+1;-1 | | InChIKey | MFXLOVLEQJRXFP-UHFFFAOYSA-N | | SMILES | N1(CCCCCC)C=C[N+](C)=C1.[B-](F)(F)(F)F | | CAS DataBase Reference | 244193-50-8(CAS DataBase Reference) | | ECW | 5.1 V |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 23-24/25-37/39-26 | | RIDADR | 1760 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29332900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 1-Hexyl-3-methylimidazolium tetrafluoroborate Usage And Synthesis |
| Conductivity | 1.18 mS/cm (20 °C) | | Chemical Properties | Clear yellow to orange viscous liquid |
| | 1-Hexyl-3-methylimidazolium tetrafluoroborate Preparation Products And Raw materials |
|