|
|
| | 2,4-Dichloro-6-nitrophenol Basic information |
| Product Name: | 2,4-Dichloro-6-nitrophenol | | Synonyms: | 2,4-Dichlor-6-nitrofenol;2,4-dichloro-6-nitro-pheno;2-Nitro-4,6-dichlorophenol;Moistsolidcontaining20%water;2,4-Dichloro-6-nitrophenol, moist solid containing 20% water, 98%;2,4-DICHLORO-6-NITROPHENOL;4,6-Dichloro-2-nitrophenol;Phenol, 2,4-dichloro-6-nitro- | | CAS: | 609-89-2 | | MF: | C6H3Cl2NO3 | | MW: | 208 | | EINECS: | 210-202-2 | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Phenols;Building Blocks;C6 to C8;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds | | Mol File: | 609-89-2.mol |  |
| | 2,4-Dichloro-6-nitrophenol Chemical Properties |
| Melting point | 118-120 °C (lit.) | | Boiling point | 242.8±35.0 °C(Predicted) | | density | 1.5643 (rough estimate) | | refractive index | 1.6390 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 4+-.0.38(Predicted) | | form | Powder | | color | Yellow | | BRN | 2050081 | | InChI | 1S/C6H3Cl2NO3/c7-3-1-4(8)6(10)5(2-3)9(11)12/h1-2,10H | | InChIKey | LYPMXMBQPXPNIQ-UHFFFAOYSA-N | | SMILES | Oc1c(Cl)cc(Cl)cc1[N+]([O-])=O | | CAS DataBase Reference | 609-89-2(CAS DataBase Reference) | | NIST Chemistry Reference | Phenol, 2,4-dichloro-6-nitro-(609-89-2) |
| Hazard Codes | Xn | | Risk Statements | 22-36-41-20/21/22 | | Safety Statements | 26-36/37/39-28 | | RIDADR | UN 2811 | | WGK Germany | 3 | | RTECS | SL0350000 | | F | 4.5 | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29089990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2,4-Dichloro-6-nitrophenol Usage And Synthesis |
| Chemical Properties | yellow to orange powder | | Uses | 2,4-Dichloro-6-nitrophenol, a specific inhibitor of sulfotransferases, was used to reduce the neosynthesis of [3H] pregnenolone sulfate (Δ5PS) and [3H]dehydroepiandrosterone sulfate (DHEAS). | | General Description | The FT-Raman and FTIR spectra of 2,4-dichloro-6-nitrophenol (2,4-DC6NP) was studied. | | Purification Methods | Crystallise the chloronitrophenol from AcOH. [Beilstein 6 IV 1358.] |
| | 2,4-Dichloro-6-nitrophenol Preparation Products And Raw materials |
|