| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Fluoro-3-(trifluoromethyl)benzoic acid Basic information |
| | 2-Fluoro-3-(trifluoromethyl)benzoic acid Chemical Properties |
| Melting point | 126-128 °C (lit.) | | Boiling point | 249.6±40.0 °C(Predicted) | | density | 1.489±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 2.84±0.10(Predicted) | | form | Crystalline Powder | | color | White to beige | | InChI | InChI=1S/C8H4F4O2/c9-6-4(7(13)14)2-1-3-5(6)8(10,11)12/h1-3H,(H,13,14) | | InChIKey | XVEAMDNSCPPPCP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(C(F)(F)F)=C1F | | CAS DataBase Reference | 115029-22-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Fluoro-3-(trifluoromethyl)benzoic acid Usage And Synthesis |
| Chemical Properties | White to beige crystalline powder | | Uses | 2-Fluoro-3-(trifluoromethyl)benzoic acid may be used in chemical synthesis. |
| | 2-Fluoro-3-(trifluoromethyl)benzoic acid Preparation Products And Raw materials |
|