| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
N-Benzylquininium chloride manufacturers
|
| | N-Benzylquininium chloride Basic information |
| | N-Benzylquininium chloride Chemical Properties |
| Melting point | 200-205 °C (dec.) (lit.) | | refractive index | 227.5 ° (C=1.5, H2O) | | storage temp. | 2-8°C | | solubility | freely sol H2O, alcohols, acetone; slightly sol EtOAc; sparingly sol CHCl3 | | form | powder to crystal | | color | White to Light yellow | | Optical Rotation | [α]20/D 235°, c = 1.5 in H2O | | BRN | 5702637 | | InChIKey | JYDIJFKNXHPWBJ-GOGFHWEMSA-M | | SMILES | [Cl-].COc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CC[N@+]3(C[C@@H]4C=C)Cc5ccccc5)c2c1 | | CAS DataBase Reference | 67174-25-8 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | N-Benzylquininium chloride Usage And Synthesis |
| Chemical Properties | Off-white to brown powder | | Uses | N-Benzylquininium chloride can be used as a phase transfer catalyst:
- In the sulfenylation of various β-keto sulfoxides.
- To synthesize N-carbamoyl-protected β-nitroamines from α-amido sulfones by asymmetric aza-Henry reaction.
| | General Description | N-Benzylquininium chloride (or Quibec) belongs to the class of cinchona family of alkaloids. It is used as a catalyst in the presence of hydroxide bases in various phase transfer reactions, epoxidations, alkylations, and Michael reactions. |
| | N-Benzylquininium chloride Preparation Products And Raw materials |
|