| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Trifluoromethylphenylboronic acid, pinacol ester manufacturers
|
| | 4-Trifluoromethylphenylboronic acid, pinacol ester Basic information |
| Product Name: | 4-Trifluoromethylphenylboronic acid, pinacol ester | | Synonyms: | 4,4,5,5-TETRAMETHYL-2-(4-TRIFLUOROMETHYLPHENYL)-1,3,2-DIOXABOROLANE;2-(4-(trifluoroMethyl)phenyl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane;4,4,5,5-Tetramethyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (This product is only available in Japan.);4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)trifluoromethylbenzene;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-(trifluoromethyl)phenyl]-;1-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)benzene;4-Trifluoromethylphenylboronic Acid Pnacol Ester;4,4,5,5-tetramethyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-diox... | | CAS: | 214360-65-3 | | MF: | C13H16BF3O2 | | MW: | 272.07 | | EINECS: | | | Product Categories: | | | Mol File: | 214360-65-3.mol |  |
| | 4-Trifluoromethylphenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 68-69 °C | | Boiling point | 291.4±40.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | color | White | | InChI | InChI=1S/C13H16BF3O2/c1-11(2)12(3,4)19-14(18-11)10-7-5-9(6-8-10)13(15,16)17/h5-8H,1-4H3 | | InChIKey | GCQADNWXVSTJQW-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C1=CC=C(C(F)(F)F)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | HS Code | 2931900090 |
| | 4-Trifluoromethylphenylboronic acid, pinacol ester Usage And Synthesis |
| | 4-Trifluoromethylphenylboronic acid, pinacol ester Preparation Products And Raw materials |
| Raw materials | Benzene, 1,1'-sulfinylbis[4-(trifluoromethyl)--->2-(4-Bromo-phenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane-->4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)aniline-->4-Chlorobenzotrifluoride-->2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane-->Pinacol-->4-Iodobenzotrifluoride-->4-Bromobenzotrifluoride-->Pinacolborane | | Preparation Products | 3-Trifluoromethylphenylboronic acid, pinacol ester-->Benzotrifluoride-->4-Fluorobenzotrifluoride |
|