| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Fluoro-4-trifluoromethylphenylboronic acid, pinacol ester Basic information |
| Product Name: | 2-Fluoro-4-trifluoromethylphenylboronic acid, pinacol ester | | Synonyms: | 2-(2-Fluoro-4-(trifluoroMethyl)phenyl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-;2-Fluoro-4-trifluoromethylphenylboronic acid, pinacol ester | | CAS: | 1073353-68-0 | | MF: | C13H15BF4O2 | | MW: | 290.06 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Fluoro-4-trifluoromethylphenylboronic acid, pinacol ester Chemical Properties |
| Boiling point | 288.1±40.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C13H15BF4O2/c1-11(2)12(3,4)20-14(19-11)9-6-5-8(7-10(9)15)13(16,17)18/h5-7H,1-4H3 | | InChIKey | ZXEYGQNXUCXTBK-UHFFFAOYSA-N | | SMILES | FC(F)(F)C1=CC(F)=C(B2OC(C)(C)C(C)(C)O2)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Fluoro-4-trifluoromethylphenylboronic acid, pinacol ester Usage And Synthesis |
| Uses | 2-Fluoro-4-trifluoromethylphenylboronic acid, pinacol ester |
| | 2-Fluoro-4-trifluoromethylphenylboronic acid, pinacol ester Preparation Products And Raw materials |
|