|
|
| | 2,3-Dihydroxypropyl methacrylate Basic information |
| Product Name: | 2,3-Dihydroxypropyl methacrylate | | Synonyms: | 2,3-dihydroxypropylmethacrylate(glycerylmono-methacrylate);2-Methyl-2-propenoicacid,2,3-dihydroxypropylester;2-Propenoicacid,2-methyl-,2,3-dihydroxypropylester;Dihydroxypropyl methacrylate;Glycerylmethacrylate;GLYCERYL MONO-METHACRYLATE;Glycerin 1-methacrylate;Glycerol 1-methacrylate | | CAS: | 5919-74-4 | | MF: | C7H12O4 | | MW: | 160.17 | | EINECS: | 227-642-6 | | Product Categories: | monomer | | Mol File: | 5919-74-4.mol |  |
| | 2,3-Dihydroxypropyl methacrylate Chemical Properties |
| Melting point | 140℃/0.6mm | | Boiling point | 140°C 0,6mm | | density | 1.161±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C(protect from light) | | pka | 13.09±0.20(Predicted) | | form | oil | | color | Colourless | | Water Solubility | 100g/L at 25℃ | | Cosmetics Ingredients Functions | FILM FORMING | | InChI | InChI=1S/C7H12O4/c1-5(2)7(10)11-4-6(9)3-8/h6,8-9H,1,3-4H2,2H3 | | InChIKey | QRIMLDXJAPZHJE-UHFFFAOYSA-N | | SMILES | C(OCC(O)CO)(=O)C(C)=C | | LogP | -0.12 at 23℃ | | EPA Substance Registry System | 2,3-Dihydroxypropyl methacrylate (5919-74-4) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | TSCA | TSCA listed | | HS Code | 2918199890 |
| | 2,3-Dihydroxypropyl methacrylate Usage And Synthesis |
| Uses |
2,3-dihydroxypropyl methacrylate is used as a laboratory reagent.
| | Flammability and Explosibility | Not classified |
| | 2,3-Dihydroxypropyl methacrylate Preparation Products And Raw materials |
|