| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
- 1,1'-DIETHYLFERROCENE
-
- $15.00
-
2025-02-13
- CAS:1273-97-8
- Min. Order: 1kg
- Purity: 99.99%
- Supply Ability: 10 tons
|
| | 1,1'-Diethylferrocene Basic information | | Uses |
| Product Name: | 1,1'-Diethylferrocene | | Synonyms: | BIS(ETHYLCYCLOPENTADIENYL)IRON;Bis(ethylcyclopentadienyl)iron,min.98%;Bis(ethylcyclopentadienyl)iron, min. 98%;1,1'-Diethylferrocene,98%;1,1'-DiethyL;1,1'-Diethylferrocene 98%;Ferrocene, 1,1'-diethyl- (8CI,9CI);1,1-Diethylferrocene CAS NO.1273-97-8 | | CAS: | 1273-97-8 | | MF: | C14H18Fe10* | | MW: | 242.14 | | EINECS: | 000-000-0 | | Product Categories: | Miscellaneous;Precursors by Metal;Vapor Deposition Precursors;Industrial/Fine Chemicals | | Mol File: | 1273-97-8.mol |  |
| | 1,1'-Diethylferrocene Chemical Properties |
| Boiling point | 284 °C(lit.) | | density | 1.18 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.58(lit.) | | Fp | 230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | liquid | | color | orange | | Specific Gravity | 1.180 | | Water Solubility | Insoluble | | InChI | InChI=1S/2C7H9.Fe/c2*1-2-7-5-3-4-6-7;/h2*3-6H,2H2,1H3; | | InChIKey | GKKLDIHVIQZCPZ-UHFFFAOYSA-N | | SMILES | [C]1(CC)[CH][CH][CH][CH]1.[C]1(CC)[CH][CH][CH][CH]1.[Fe] |^1:0,3,4,5,6,7,10,11,12,13| | | CAS DataBase Reference | 1273-97-8 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29310099 | | Toxicity | mammal (species unspecified),LC,inhalation,> 26mg/m3 (26mg/m3),BRAIN AND COVERINGS: RECORDINGS FROM SPECIFIC AREAS OF CNSCARDIAC: OTHER CHANGESLIVER: LIVER FUNCTION TESTS IMPAIRED,"Spravochnik po Toksikologii i Gigienicheskim Normativam Vol. -, Pg. 28, 1999. |
| | 1,1'-Diethylferrocene Usage And Synthesis |
| Uses | 1,1'-Diethylferrocene is used in organic synthesis and can be applied in laboratory research and development processes as well as in chemical and pharmaceutical synthesis. | | Chemical Properties | clear dark orange to dark red brown liquid |
| | 1,1'-Diethylferrocene Preparation Products And Raw materials |
|