| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | (S)-(+)-1-Benzyloxy-2-propanol Basic information |
| Product Name: | (S)-(+)-1-Benzyloxy-2-propanol | | Synonyms: | 1-phenylmethoxy-2-propanol;(S)-(+)-1-BENZYLOXY-2-PROPANOL 97;(2S)-1-benzyloxypropan-2-ol;2-Propanol,1-(phenylMethoxy)-, (2S)-;(S)-(+)-1-Benzyloxy-2-propanol 97%;(S)-(+)-1-Benzyloxy-2-propanol >Benzyl (S)-(+)-2-Hydroxypropyl Ether;(2S)-1-phenylmethoxypropan-2-ol | | CAS: | 85483-97-2 | | MF: | C10H14O2 | | MW: | 166.22 | | EINECS: | | | Product Categories: | | | Mol File: | 85483-97-2.mol |  |
| | (S)-(+)-1-Benzyloxy-2-propanol Chemical Properties |
| Boiling point | 130-132℃ (14 Torr) | | density | 1.044 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.510(lit.) | | Fp | 228 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 14.46±0.20(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Optical Rotation | [α]20/D +14.5°, c = 1 in chloroform | | InChI | InChI=1S/C10H14O2/c1-9(11)7-12-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-/m0/s1 | | InChIKey | KJBPYIUAQLPHJG-VIFPVBQESA-N | | SMILES | C(OCC1=CC=CC=C1)[C@@H](O)C | | CAS DataBase Reference | 85483-97-2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 2 | | HS Code | 2906290090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(+)-1-Benzyloxy-2-propanol Usage And Synthesis |
| Description | (S)-(+)-1-BENZYLOXY-2-PROPANOL is a versatile chiral building block widely utilized in organic synthesis and pharmaceutical applications. | | Uses | (S)-(+)-1-Benzyloxy-2-propanol can be used as a reactant to prepare:
- (S)-N-(2-phosphonomethoxypropyl) derivatives of purine and pyrimidine bases (PMP derivatives).
- (S)-1-(benzyloxy)propan-2-yl 4-methylbenzenesulfonate by reacting with tosyl chloride in pyridine.
| | General Description | (S)-(+)-1-Benzyloxy-2-propanol can be used as an effective antiwear agent in aviation turbine fuels, diesel fuels, and light mineral oil. |
| | (S)-(+)-1-Benzyloxy-2-propanol Preparation Products And Raw materials |
|