- N6-Bz-DMT-2'-dA
-
- $0.00 / 100g
-
2024-08-08
- CAS:64325-78-6
- Min. Order: 100g
- Purity: ≥98%(HPLC)
- Supply Ability: 20t
|
| | N6-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine Basic information |
| | N6-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine Chemical Properties |
| Melting point | 94 °C | | Boiling point | 681.42°C (rough estimate) | | density | 1.2199 (rough estimate) | | refractive index | -10 ° (C=1, MeOH) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 7.87±0.43(Predicted) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 140μg/L at 20℃ | | Stability: | Acid Sensitive | | InChIKey | LPICNYATEWGYHI-RLHFKRISNA-N | | SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3=C(C(=NC=N3)NC(=O)C3=CC=CC=C3)N=C2)C[C@@H]1O |&1:25,27,47,r| | | LogP | 5.94 at 20℃ | | CAS DataBase Reference | 64325-78-6(CAS DataBase Reference) | | EPA Substance Registry System | Adenosine, N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy- (64325-78-6) |
| | N6-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine Usage And Synthesis |
| Chemical Properties | white granular solid | | Uses | N6-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine is useful in various DNA and RNA projects ranging from modification to site-selective activation, and many other projects. | | Flammability and Explosibility | Not classified |
| | N6-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine Preparation Products And Raw materials |
|