|
|
| | 5 12-BIS(PHENYLETHYNYL)NAPHTHACENE TEC& Basic information |
| Product Name: | 5 12-BIS(PHENYLETHYNYL)NAPHTHACENE TEC& | | Synonyms: | 5,12-bis(2-phenylethynyl)tetracene;BPEN, 5,12-bis(phenylethynyl)naphthacene;5,12-bis(phenylethynyl)-naphthacen;5 12-BIS(PHENYLETHYNYL)NAPHTHACENE TEC&;5,12-BIS(PHENYLETHYNYL)NAPHTHACENE, TECH .;Naphthacene, 5,12-bis(phenylethynyl)-;5,12-Bis(phenylethynyl)naphthacene;Einecs 242-605-4 | | CAS: | 18826-29-4 | | MF: | C34H20 | | MW: | 428.52 | | EINECS: | 242-605-4 | | Product Categories: | | | Mol File: | 18826-29-4.mol |  |
| | 5 12-BIS(PHENYLETHYNYL)NAPHTHACENE TEC& Chemical Properties |
| Melting point | 248 °C (dec.)(lit.) | | Boiling point | 683.7±28.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C34H20/c1-3-11-25(12-4-1)19-21-31-29-17-9-10-18-30(29)32(22-20-26-13-5-2-6-14-26)34-24-28-16-8-7-15-27(28)23-33(31)34/h1-18,23-24H | | InChIKey | OUHYGBCAEPBUNA-UHFFFAOYSA-N | | SMILES | C1=C2C(C(C#CC3=CC=CC=C3)=C3C(=C2C#CC2=CC=CC=C2)C=C2C(C=CC=C2)=C3)=CC=C1 | | EPA Substance Registry System | Naphthacene, 5,12-bis(phenylethynyl)- (18826-29-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | TSCA | TSCA listed |
| | 5 12-BIS(PHENYLETHYNYL)NAPHTHACENE TEC& Usage And Synthesis |
| Uses | 5,12-Bis(phenylethynyl)tetracene is a benzene derivative, which can be used as a pharmaceutical intermediate. | | Application | 5,12-Bis(phenylethynyl)tetracene is an intermediate in organic synthesis and pharmaceutical intermediate, which can be used in laboratory research and development process and chemical and pharmaceutical research and development process. | | Preparation | Add anhydrous dioxane to lithium amide, and finally recrystallize with acetonitrile to obtain 5,12-Bis(phenylethynyl)tetracene. |
| | 5 12-BIS(PHENYLETHYNYL)NAPHTHACENE TEC& Preparation Products And Raw materials |
|