| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
3-Bromo-2-chlorophenylboronic acid manufacturers
|
| | 3-Bromo-2-chlorophenylboronic acid Basic information |
| | 3-Bromo-2-chlorophenylboronic acid Chemical Properties |
| Boiling point | 372.0±52.0 °C(Predicted) | | density | 1.79±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 7.26±0.58(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H5BBrClO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,10-11H | | InChIKey | YCMXATUQDUMDGW-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC(Br)=C1Cl)(O)O |
| | 3-Bromo-2-chlorophenylboronic acid Usage And Synthesis |
| | 3-Bromo-2-chlorophenylboronic acid Preparation Products And Raw materials |
|