|
|
| | 3-Bromo-4-nitropyridine Basic information | | Uses |
| Product Name: | 3-Bromo-4-nitropyridine | | Synonyms: | IFLAB-BB F1371-0211;3-BROMO-4-NITROPYRIDINE;i3-Bromo-4-nitropyridine;Pyridine, 3-bromo-4-nitro-;3-BROMO-4-NITROPYRIDINE 97%;3-BROMO-4-NITROPYRIDINE ISO 9001:2015 REACH;Flortaucipir Impurity 26 | | CAS: | 89364-04-5 | | MF: | C5H3BrN2O2 | | MW: | 202.99 | | EINECS: | | | Product Categories: | Pyridines | | Mol File: | 89364-04-5.mol |  |
| | 3-Bromo-4-nitropyridine Chemical Properties |
| Melting point | 66-67 °C | | Boiling point | 235.7±20.0 °C(Predicted) | | density | 1.833±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -1.04±0.18(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C5H3BrN2O2/c6-4-3-7-2-1-5(4)8(9)10/h1-3H | | InChIKey | CJEWCWSWUUFORD-UHFFFAOYSA-N | | SMILES | C1=NC=CC([N+]([O-])=O)=C1Br |
| | 3-Bromo-4-nitropyridine Usage And Synthesis |
| Uses | 3-Bromo-4-nitropyridine is a pyridine compound that has been identified as an environmental pollutant. It can be used to synthesize other compounds, such as 4-(3-bromopyridin-2-yl)morpholine, for the synthesis of acetonitrile. | | Synthesis | A mixture of 3-bromo-4-nitropyridine N-oxide (2.2g,10 mmol), trichlorooxobis (triphenylphosphine) rhenium(V) [Re(0)(Ph3P)2Cl3, Aldrich, 50 mg, 0.08mmol), and triphenyphosphine (2.7 g, 10.3 mmol) in dichloromethane (100 mL) was flushed with argon and stirred at rt for 1 h, then, at 40 °C for 2 h. The reaction mixture was cooled to rt and concentrated under vacuum. The residue was triturated with hexanes (300 mL), and the precipitated (triphenylphosphine oxide) was removed by filtration. The organic layer was concentrated and purified by column (silica gel, EtOAc/hexanes 1/7) to give 3-Bromo-4-nitropyridine as yellow solid (1.8 g, 86%)[1]. | | References | [1] R. W. Daisley, J. R. Hanbali. “PREPARATION OF 3-BROMO-4-NITROPYRIDINE 1-OXIDE.” Organic Preparations and Procedures International 15 1 (1983): 280–282. |
| | 3-Bromo-4-nitropyridine Preparation Products And Raw materials |
|