| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Chloro-2-fluorophenol Basic information |
| | 3-Chloro-2-fluorophenol Chemical Properties |
| Melting point | 34-38℃ | | Boiling point | 190°C | | density | 1.408±0.06 g/cm3(Predicted) | | Fp | 190°C | | storage temp. | Inert atmosphere,Room Temperature | | form | fused solid | | pka | 7.74±0.10(Predicted) | | color | Pale yellow | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C6H4ClFO/c7-4-2-1-3-5(9)6(4)8/h1-3,9H | | InChIKey | PCHPYNHSMSAJEU-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC(Cl)=C1F | | CAS DataBase Reference | 2613-22-1(CAS DataBase Reference) |
| Hazard Codes | T,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Hazard Note | Toxic | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HazardClass | 8 | | HS Code | 2908190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |
| | 3-Chloro-2-fluorophenol Usage And Synthesis |
| Uses | 3-Chloro-2-fluorophenol are employed in the preparation of resins, dyes, explosives, lubricants, and plastics. Also they are are endowed with antioxidant property and are used as antioxidants in many formulations such as pharmaceuticals, cosmetics, electrical transformer oil, solvents, and organic reactions. |
| | 3-Chloro-2-fluorophenol Preparation Products And Raw materials |
|