| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 3-Chloro-4-fluorophenol
-
- $100.00
-
2024-04-23
- CAS:2613-23-2
- Min. Order: 1kg
- Purity: 99.93%
- Supply Ability: 1000kg per week
|
| | 3-Chloro-4-fluorophenol Basic information |
| | 3-Chloro-4-fluorophenol Chemical Properties |
| Melting point | 38-40 °C (lit.) | | Boiling point | 104 °C/11 mmHg (lit.) | | density | 1.3675 (estimate) | | Fp | 228 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.01±0.18(Predicted) | | form | Crystalline Solid | | color | Beige to brownish | | BRN | 3236443 | | InChI | InChI=1S/C6H4ClFO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H | | InChIKey | ZQXLIXHVJVAPLW-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(F)C(Cl)=C1 | | CAS DataBase Reference | 2613-23-2(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Chloro-4-fluorophenol(2613-23-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-37/39-36/37/39 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HazardClass | 8 | | HS Code | 29081990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Chloro-4-fluorophenol Usage And Synthesis |
| Chemical Properties | Cream-colored to brown solid | | Uses | 3-Chloro-4-fluorophenol post-translationally stabilizes survival motor neuron protein for treatment of spinal muscular atrophy. | | Uses | 3-Chloro-4-fluorophenol has been used in the preparation of 3-chloro-4-fluoro-2′-methoxycarbonyldiphenyl ether required for the synthesis of flavone and xanthone derivatives. | | Definition | ChEBI: 3-Chloro-4-fluorophenol is a halophenol and an organofluorine compound. |
| | 3-Chloro-4-fluorophenol Preparation Products And Raw materials |
|