| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | Adipoyl-L-carnitine Basic information |
| | Adipoyl-L-carnitine Chemical Properties |
| storage temp. | -20°C | | solubility | DMSO (Slightly, Sonicated), Methanol (Slightly), Water (Slightly) | | form | Thick Oil to Gel | | color | Colourless | | Optical Rotation | [α]/D -22.0 to -16.0°, c =0.1 in H2O | | Stability: | Hygroscopic | | InChI | 1S/C13H23NO6/c1-14(2,3)9-10(8-12(17)18)20-13(19)7-5-4-6-11(15)16/h10H,4-9H2,1-3H3,(H-,15,16,17,18)/t10-/m1/s1 | | InChIKey | BSVHAXJKBCWVDA-SNVBAGLBSA-N | | SMILES | [N+](C[C@H](OC(=O)CCCCC(=O)[O-])CC(=O)[O-])(C)(C)C.[H+] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Adipoyl-L-carnitine Usage And Synthesis |
| Uses | Adipoyl-L-carnitine is a serum metabolite that varies in concentration in response to normal daily activities including food intake. |
| | Adipoyl-L-carnitine Preparation Products And Raw materials |
|