| Company Name: |
Foshan Heshuo Pharm technology Co., ltd Gold
|
| Tel: |
15363639686 |
| Email: |
heshuoyiyao@hotmail.com |
| Products Intro: |
Product Name:Adipoyl-L-carnitine
CAS:102636-83-9
Purity:98%+ Package:50mg;100mg;500mg
|
| Company Name: |
Shanghai Aladdin Biochemical Technology Co.,Ltd.
|
| Tel: |
6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:Adipoyl-L-carnitine trifluoroacetate
CAS:102636-83-9
Purity:≥98% Package:5mg/RMB 469.90;25mg/RMB 1649.90;100mg/RMB 4599.90
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Adipoyl-L-carnitine lithium salt
CAS:102636-83-9
|
|
| | Adipoyl-L-carnitine Basic information |
| | Adipoyl-L-carnitine Chemical Properties |
| storage temp. | -20°C | | solubility | DMSO (Slightly, Sonicated), Methanol (Slightly), Water (Slightly) | | form | Thick Oil to Gel | | color | Colourless | | Optical Rotation | [α]/D -22.0 to -16.0°, c =0.1 in H2O | | Stability: | Hygroscopic | | InChI | 1S/C13H23NO6/c1-14(2,3)9-10(8-12(17)18)20-13(19)7-5-4-6-11(15)16/h10H,4-9H2,1-3H3,(H-,15,16,17,18)/t10-/m1/s1 | | InChIKey | BSVHAXJKBCWVDA-SNVBAGLBSA-N | | SMILES | [N+](C[C@H](OC(=O)CCCCC(=O)[O-])CC(=O)[O-])(C)(C)C.[H+] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Adipoyl-L-carnitine Usage And Synthesis |
| Uses | Adipoyl-L-carnitine is a serum metabolite that varies in concentration in response to normal daily activities including food intake. |
| | Adipoyl-L-carnitine Preparation Products And Raw materials |
|