| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Bromo-6-chlorotoluene Basic information |
| | 2-Bromo-6-chlorotoluene Chemical Properties |
| Boiling point | 100°C 25mm | | density | 1,56 g/cm3 | | Fp | 95°C | | refractive index | 1.5780 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | Specific Gravity | 1.58 | | color | Colorless to Light red to Green | | InChI | InChI=1S/C7H6BrCl/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 | | InChIKey | DMARBQGIQKLIPM-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(Cl)=C1C | | CAS DataBase Reference | 62356-27-8(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-Bromo-6-chlorotoluene Usage And Synthesis |
| Chemical Properties | Colorless liquid |
| | 2-Bromo-6-chlorotoluene Preparation Products And Raw materials |
|