| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Chlorobenzyl bromide Basic information |
| | 4-Chlorobenzyl bromide Chemical Properties |
| Melting point | 48-52 °C (lit.) | | Boiling point | 107-108°C 8mm | | density | 1.570±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform, Dichloromethane (Slightly) | | form | Crystalline Low Melting Solid | | color | White | | Water Solubility | Insoluble in water. | | Sensitive | Lachrymatory | | BRN | 606497 | | InChI | InChI=1S/C7H6BrCl/c8-5-6-1-3-7(9)4-2-6/h1-4H,5H2 | | InChIKey | KQNBRMUBPRGXSL-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC=C(Cl)C=C1 | | CAS DataBase Reference | 622-95-7(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Chlorobenzyl bromide(622-95-7) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-Chlorobenzyl bromide Usage And Synthesis |
| Chemical Properties | White crystalline low melting solid | | Uses | 4-Chlorobenzyl bromide is used as pharmaceutical intermediate. | | Uses | 4-Chlorobenzyl bromide may be used to synthesize 1-(4-chlorobenzyl)-2-(pyrrolidin-1-yl-methyl)-1H-benzimidazole dihydrochloride | | General Description | 4-Chlorobenzyl bromide undergoes carbonylation in the presence of dimer of chloro(1,5-cyclooctadiene)rhodium(I) to yield the corresponding phenylacetic acid. It can be synthesized by reacting 4-chlorobenzyl alcohol with bromodimethylsulfonium bromide (BDMS) It can also be synthesized by refluxing a mixture of 4-chlorobenzaldehyde, chlorotrimethylsilane, 1,1,3,3-tetramethyldisiloxane and lithium bromide. |
| | 4-Chlorobenzyl bromide Preparation Products And Raw materials |
|